C22H34O — CID 171642735
2-[(1R,3R,5S,7R,11S,16R)-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]acetaldehyde (PubChem CID 171642735) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is 2-[(1R,3R,5S,7R,11S,16R)-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]acetaldehyde.
| Compound Name | 2-[(1R,3R,5S,7R,11S,16R)-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]acetaldehyde |
|---|---|
| PubChem CID | 171642735 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 2-[(1R,3R,5S,7R,11S,16R)-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]acetaldehyde |
| SMILES | CC1CC[C@@H]2C3CC[C@]4(C)C(CC=O)[C@H]5CC5C4[C@@H]3CC[C@@H]2C1 |
| InChI | InChI=1S/C22H34O/c1-13-3-5-15-14(11-13)4-6-17-16(15)7-9-22(2)20(8-10-23)18-12-19(18)21(17)22/h10,13-21H,3-9,11-12H2,1-2H3/t13?,14-,15+,16?,17-,18+,19?,20?,21?,22-/m1/s1 |
| InChIKey | XPPILYWQOFAQIW-KAXAUSNDSA-N |
| XLogP | 5.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|