C22H36O — CID 171643095
1-[(1R,3R,5S,11S,16R)-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]ethanol (PubChem CID 171643095) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is 1-[(1R,3R,5S,11S,16R)-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]ethanol.
| Compound Name | 1-[(1R,3R,5S,11S,16R)-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]ethanol |
|---|---|
| PubChem CID | 171643095 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | 1-[(1R,3R,5S,11S,16R)-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]ethanol |
| SMILES | CC1CC[C@@H]2C3CCC4(C)C(C5C[C@@H]5C4C(C)O)[C@@H]3CC[C@@H]2C1 |
| InChI | InChI=1S/C22H36O/c1-12-4-6-15-14(10-12)5-7-17-16(15)8-9-22(3)20(13(2)23)18-11-19(18)21(17)22/h12-21,23H,4-11H2,1-3H3/t12?,13?,14-,15+,16?,17-,18+,19?,20?,21?,22?/m1/s1 |
| InChIKey | HYZPYDUQPVOLIV-DNAKUTQHSA-N |
| XLogP | 5.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |