C25H37F2N3O — CID 162620352
1-[(3S,5R,6S,7S,10R,14S,16R)-4,4-difluoro-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-(4-methyltriazol-2-yl)ethanol (PubChem CID 162620352) has the molecular formula C25H37F2N3O and a molecular weight of 433.59 g/mol. Its IUPAC name is 1-[(3S,5R,6S,7S,10R,14S,16R)-4,4-difluoro-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-(4-methyltriazol-2-yl)ethanol.
| Compound Name | 1-[(3S,5R,6S,7S,10R,14S,16R)-4,4-difluoro-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-(4-methyltriazol-2-yl)ethanol |
|---|---|
| PubChem CID | 162620352 |
| Molecular Formula | C25H37F2N3O |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | 1-[(3S,5R,6S,7S,10R,14S,16R)-4,4-difluoro-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-(4-methyltriazol-2-yl)ethanol |
| SMILES | Cc1cnn(CC(O)[C@H]2[C@@H]3[C@H](C4C5CC[C@@H]6C[C@@H](C)CCC6[C@H]5CC[C@@]42C)C3(F)F)n1 |
| InChI | InChI=1S/C25H37F2N3O/c1-13-4-6-16-15(10-13)5-7-18-17(16)8-9-24(3)20(18)22-23(25(22,26)27)21(24)19(31)12-30-28-11-14(2)29-30/h11,13,15-23,31H,4-10,12H2,1-3H3/t13-,15+,16?,17+,18?,19?,20?,21-,22-,23+,24-/m0/s1 |
| InChIKey | KUTATGULDRJSJL-MCQYSCINSA-N |
| XLogP | 4.95 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |