C23H34N2 — CID 145443107
4-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-17-yl)-1-methylpyrazole (PubChem CID 145443107) has the molecular formula C23H34N2 and a molecular weight of 338.54 g/mol. Its IUPAC name is 4-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-17-yl)-1-methylpyrazole.
| Compound Name | 4-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-17-yl)-1-methylpyrazole |
|---|---|
| PubChem CID | 145443107 |
| Molecular Formula | C23H34N2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 4-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-17-yl)-1-methylpyrazole |
| SMILES | CC1CCC2C(CCC3C2CCC2(C)C(c4cnn(C)c4)=CCC32)C1 |
| InChI | InChI=1S/C23H34N2/c1-15-4-6-18-16(12-15)5-7-20-19(18)10-11-23(2)21(8-9-22(20)23)17-13-24-25(3)14-17/h8,13-16,18-20,22H,4-7,9-12H2,1-3H3 |
| InChIKey | VMGWDEHHFVRCPS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |