C22H35F3O — CID 171642409
1-[(13S)-13,15-dimethyl-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanol (PubChem CID 171642409) has the molecular formula C22H35F3O and a molecular weight of 372.52 g/mol. Its IUPAC name is 1-[(13S)-13,15-dimethyl-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanol.
| Compound Name | 1-[(13S)-13,15-dimethyl-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanol |
|---|---|
| PubChem CID | 171642409 |
| Molecular Formula | C22H35F3O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 1-[(13S)-13,15-dimethyl-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanol |
| SMILES | CC(O)C1CC(C)C2C3CCC4CC(C(F)(F)F)CCC4C3CC[C@]12C |
| InChI | InChI=1S/C22H35F3O/c1-12-10-19(13(2)26)21(3)9-8-17-16-7-5-15(22(23,24)25)11-14(16)4-6-18(17)20(12)21/h12-20,26H,4-11H2,1-3H3/t12?,13?,14?,15?,16?,17?,18?,19?,20?,21-/m1/s1 |
| InChIKey | PQSOZCGUIKECEP-BTUVVMAOSA-N |
| XLogP | 6.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |