C25H41F3O — CID 171642407
ethane;2-[(1S)-1-[(3S)-13-methyl-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethyl]oxirane (PubChem CID 171642407) has the molecular formula C25H41F3O and a molecular weight of 414.60 g/mol. Its IUPAC name is ethane;2-[(1S)-1-[(3S)-13-methyl-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethyl]oxirane.
| Compound Name | ethane;2-[(1S)-1-[(3S)-13-methyl-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethyl]oxirane |
|---|---|
| PubChem CID | 171642407 |
| Molecular Formula | C25H41F3O |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | ethane;2-[(1S)-1-[(3S)-13-methyl-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethyl]oxirane |
| SMILES | CC.C[C@H](C1CO1)C1CCC2C3CCC4C[C@@H](C(F)(F)F)CCC4C3CCC21C |
| InChI | InChI=1S/C23H35F3O.C2H6/c1-13(21-12-27-21)19-7-8-20-18-5-3-14-11-15(23(24,25)26)4-6-16(14)17(18)9-10-22(19,20)2;1-2/h13-21H,3-12H2,1-2H3;1-2H3/t13-,14?,15-,16?,17?,18?,19?,20?,21?,22?;/m0./s1 |
| InChIKey | NQDYNVNPNGZSEN-XTOCNSJUSA-N |
| XLogP | 7.49 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|