C24H39F3O — CID 171643030
1-[(10S)-13,15-dimethyl-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone;ethane (PubChem CID 171643030) has the molecular formula C24H39F3O and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-[(10S)-13,15-dimethyl-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone;ethane.
| Compound Name | 1-[(10S)-13,15-dimethyl-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone;ethane |
|---|---|
| PubChem CID | 171643030 |
| Molecular Formula | C24H39F3O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 1-[(10S)-13,15-dimethyl-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethanone;ethane |
| SMILES | CC.CC(=O)C1CC(C)C2C3CCC4CC(C(F)(F)F)CC[C@@H]4C3CCC12C |
| InChI | InChI=1S/C22H33F3O.C2H6/c1-12-10-19(13(2)26)21(3)9-8-17-16-7-5-15(22(23,24)25)11-14(16)4-6-18(17)20(12)21;1-2/h12,14-20H,4-11H2,1-3H3;1-2H3/t12?,14?,15?,16-,17?,18?,19?,20?,21?;/m0./s1 |
| InChIKey | JXPUHXAZJIQBLH-MWRYYVLVSA-N |
| XLogP | 7.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |