C19H25F3O — CID 171642753
(10S,13S)-13-methyl-3-(trifluoromethyl)-2,3,4,5,6,7,8,9,10,11,12,14-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 171642753) has the molecular formula C19H25F3O and a molecular weight of 326.40 g/mol. Its IUPAC name is (10S,13S)-13-methyl-3-(trifluoromethyl)-2,3,4,5,6,7,8,9,10,11,12,14-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (10S,13S)-13-methyl-3-(trifluoromethyl)-2,3,4,5,6,7,8,9,10,11,12,14-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 171642753 |
| Molecular Formula | C19H25F3O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (10S,13S)-13-methyl-3-(trifluoromethyl)-2,3,4,5,6,7,8,9,10,11,12,14-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC3C(CCC4CC(C(F)(F)F)CC[C@@H]43)C1C=CC2=O |
| InChI | InChI=1S/C19H25F3O/c1-18-9-8-14-13-5-3-12(19(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)23/h6-7,11-16H,2-5,8-10H2,1H3/t11?,12?,13-,14?,15?,16?,18-/m0/s1 |
| InChIKey | ZFQBLSXFLDKRCV-HMNBYKQISA-N |
| XLogP | 5.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |