C27H37F3 — CID 171643236
(3S,5R,10S)-13-methyl-17-(2-phenylethyl)-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene (PubChem CID 171643236) has the molecular formula C27H37F3 and a molecular weight of 418.59 g/mol. Its IUPAC name is (3S,5R,10S)-13-methyl-17-(2-phenylethyl)-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene.
| Compound Name | (3S,5R,10S)-13-methyl-17-(2-phenylethyl)-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 171643236 |
| Molecular Formula | C27H37F3 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | (3S,5R,10S)-13-methyl-17-(2-phenylethyl)-3-(trifluoromethyl)-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene |
| SMILES | CC12CCC3C(CC[C@@H]4C[C@@H](C(F)(F)F)CC[C@H]34)C1CCC2CCc1ccccc1 |
| InChI | InChI=1S/C27H37F3/c1-26-16-15-23-22-13-10-21(27(28,29)30)17-19(22)8-12-24(23)25(26)14-11-20(26)9-7-18-5-3-2-4-6-18/h2-6,19-25H,7-17H2,1H3/t19-,20?,21+,22+,23?,24?,25?,26?/m1/s1 |
| InChIKey | GJLKZGBFLHWGOQ-VZTYMVFESA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |