C30H45N — CID 171642821
4-[2-[(3S,5R,8R,10S,13R)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethyl]benzonitrile;ethane (PubChem CID 171642821) has the molecular formula C30H45N and a molecular weight of 419.70 g/mol. Its IUPAC name is 4-[2-[(3S,5R,8R,10S,13R)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethyl]benzonitrile;ethane.
| Compound Name | 4-[2-[(3S,5R,8R,10S,13R)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethyl]benzonitrile;ethane |
|---|---|
| PubChem CID | 171642821 |
| Molecular Formula | C30H45N |
| Molecular Weight | 419.70 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | 4-[2-[(3S,5R,8R,10S,13R)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethyl]benzonitrile;ethane |
| SMILES | CC.C[C@H]1CC[C@@H]2C3CC[C@]4(C)C(CCc5ccc(C#N)cc5)CCC4[C@@H]3CC[C@@H]2C1 |
| InChI | InChI=1S/C28H39N.C2H6/c1-19-3-12-24-22(17-19)9-13-26-25(24)15-16-28(2)23(11-14-27(26)28)10-8-20-4-6-21(18-29)7-5-20;1-2/h4-7,19,22-27H,3,8-17H2,1-2H3;1-2H3/t19-,22+,23?,24-,25?,26+,27?,28+;/m0./s1 |
| InChIKey | ZZBCDEXXARZUSW-MSLUIOKLSA-N |
| XLogP | 8.42 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.70 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |