C28H40N2 — CID 146659464
4-[1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethylamino]benzonitrile (PubChem CID 146659464) has the molecular formula C28H40N2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 4-[1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethylamino]benzonitrile.
| Compound Name | 4-[1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 146659464 |
| Molecular Formula | C28H40N2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 4-[1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)ethylamino]benzonitrile |
| SMILES | CC1CCC2C(CCC3C2CCC2(C)C(C(C)Nc4ccc(C#N)cc4)CCC32)C1 |
| InChI | InChI=1S/C28H40N2/c1-18-4-10-23-21(16-18)7-11-25-24(23)14-15-28(3)26(12-13-27(25)28)19(2)30-22-8-5-20(17-29)6-9-22/h5-6,8-9,18-19,21,23-27,30H,4,7,10-16H2,1-3H3 |
| InChIKey | YEFMMMRTPCLWAG-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |