C27H41NO2S — CID 174138035
N-[(1S)-1-[(3S,5R,8R,10S,13S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethyl]benzenesulfonamide (PubChem CID 174138035) has the molecular formula C27H41NO2S and a molecular weight of 443.70 g/mol. Its IUPAC name is N-[(1S)-1-[(3S,5R,8R,10S,13S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethyl]benzenesulfonamide.
| Compound Name | N-[(1S)-1-[(3S,5R,8R,10S,13S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 174138035 |
| Molecular Formula | C27H41NO2S |
| Molecular Weight | 443.70 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | N-[(1S)-1-[(3S,5R,8R,10S,13S)-3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]ethyl]benzenesulfonamide |
| SMILES | C[C@H]1CC[C@@H]2C3CC[C@@]4(C)C(CCC4[C@H](C)NS(=O)(=O)c4ccccc4)[C@@H]3CC[C@@H]2C1 |
| InChI | InChI=1S/C27H41NO2S/c1-18-9-11-22-20(17-18)10-12-24-23(22)15-16-27(3)25(13-14-26(24)27)19(2)28-31(29,30)21-7-5-4-6-8-21/h4-8,18-20,22-26,28H,9-17H2,1-3H3/t18-,19-,20+,22-,23?,24+,25?,26?,27+/m0/s1 |
| InChIKey | KQBJWRJQHSYGHG-TXNYYQJSSA-N |
| XLogP | 6.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.70 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |