C22H33BrO2 — CID 147264885
2-bromo-1-[(1R,2R,3R,5S,6S,7S,10R,14R)-14-hydroxy-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]ethanone (PubChem CID 147264885) has the molecular formula C22H33BrO2 and a molecular weight of 409.41 g/mol. Its IUPAC name is 2-bromo-1-[(1R,2R,3R,5S,6S,7S,10R,14R)-14-hydroxy-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]ethanone.
| Compound Name | 2-bromo-1-[(1R,2R,3R,5S,6S,7S,10R,14R)-14-hydroxy-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]ethanone |
|---|---|
| PubChem CID | 147264885 |
| Molecular Formula | C22H33BrO2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-bromo-1-[(1R,2R,3R,5S,6S,7S,10R,14R)-14-hydroxy-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]ethanone |
| SMILES | C[C@@]1(O)CCC2C(CC[C@H]3[C@@H]4[C@@H]5C[C@@H]5[C@H](C(=O)CBr)[C@@]4(C)CC[C@H]23)C1 |
| InChI | InChI=1S/C22H33BrO2/c1-21(25)7-5-13-12(10-21)3-4-15-14(13)6-8-22(2)19(15)16-9-17(16)20(22)18(24)11-23/h12-17,19-20,25H,3-11H2,1-2H3/t12?,13?,14-,15-,16-,17+,19-,20-,21-,22+/m1/s1 |
| InChIKey | CPHAVZHROIMLKQ-RBDOUMAPSA-N |
| XLogP | 4.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|