C27H40N2O2 — CID 156680580
2-(4-ethylpyrazol-1-yl)-1-[(1R,2R,3R,5S,6S,7S,10R,11S,14R,16R)-14-hydroxy-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]ethanone (PubChem CID 156680580) has the molecular formula C27H40N2O2 and a molecular weight of 424.63 g/mol. Its IUPAC name is 2-(4-ethylpyrazol-1-yl)-1-[(1R,2R,3R,5S,6S,7S,10R,11S,14R,16R)-14-hydroxy-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]ethanone.
| Compound Name | 2-(4-ethylpyrazol-1-yl)-1-[(1R,2R,3R,5S,6S,7S,10R,11S,14R,16R)-14-hydroxy-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]ethanone |
|---|---|
| PubChem CID | 156680580 |
| Molecular Formula | C27H40N2O2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | 2-(4-ethylpyrazol-1-yl)-1-[(1R,2R,3R,5S,6S,7S,10R,11S,14R,16R)-14-hydroxy-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]ethanone |
| SMILES | CCc1cnn(CC(=O)[C@H]2[C@H]3C[C@H]3[C@H]3[C@@H]4CC[C@@H]5C[C@](C)(O)CC[C@@H]5[C@H]4CC[C@@]32C)c1 |
| InChI | InChI=1S/C27H40N2O2/c1-4-16-13-28-29(14-16)15-23(30)25-22-11-21(22)24-20-6-5-17-12-26(2,31)9-7-18(17)19(20)8-10-27(24,25)3/h13-14,17-22,24-25,31H,4-12,15H2,1-3H3/t17-,18+,19-,20-,21-,22+,24-,25-,26-,27+/m1/s1 |
| InChIKey | BQVTVNMCTDXCRX-HUFORWKYSA-N |
| XLogP | 4.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |