C25H34FN3O2 — CID 156680569
1-[(3R,5R,10S,13S,16S)-16-fluoro-3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(4-isocyanopyrazol-1-yl)ethanone (PubChem CID 156680569) has the molecular formula C25H34FN3O2 and a molecular weight of 427.56 g/mol. Its IUPAC name is 1-[(3R,5R,10S,13S,16S)-16-fluoro-3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(4-isocyanopyrazol-1-yl)ethanone.
| Compound Name | 1-[(3R,5R,10S,13S,16S)-16-fluoro-3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(4-isocyanopyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 156680569 |
| Molecular Formula | C25H34FN3O2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 1-[(3R,5R,10S,13S,16S)-16-fluoro-3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-(4-isocyanopyrazol-1-yl)ethanone |
| SMILES | [C-]#[N+]c1cnn(CC(=O)C2[C@@H](F)CC3C4CC[C@@H]5C[C@](C)(O)CC[C@@H]5C4CC[C@@]32C)c1 |
| InChI | InChI=1S/C25H34FN3O2/c1-24(31)8-6-17-15(11-24)4-5-19-18(17)7-9-25(2)20(19)10-21(26)23(25)22(30)14-29-13-16(27-3)12-28-29/h12-13,15,17-21,23,31H,4-11,14H2,1-2H3/t15-,17+,18?,19?,20?,21+,23?,24-,25+/m1/s1 |
| InChIKey | RBJZDNNMSBTNNV-BMFUGXAKSA-N |
| XLogP | 4.97 |
| TPSA | 59.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|