C26H35NO4S — CID 153333803
3-[2-[(1R,2R,3R,5S,6S,7S,10R,11S,14R,16R)-14-hydroxy-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-3-oxoprop-2-enyl]-1,3-thiazolidine-2,4-dione (PubChem CID 153333803) has the molecular formula C26H35NO4S and a molecular weight of 457.64 g/mol. Its IUPAC name is 3-[2-[(1R,2R,3R,5S,6S,7S,10R,11S,14R,16R)-14-hydroxy-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-3-oxoprop-2-enyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-[(1R,2R,3R,5S,6S,7S,10R,11S,14R,16R)-14-hydroxy-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-3-oxoprop-2-enyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 153333803 |
| Molecular Formula | C26H35NO4S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 3-[2-[(1R,2R,3R,5S,6S,7S,10R,11S,14R,16R)-14-hydroxy-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-3-oxoprop-2-enyl]-1,3-thiazolidine-2,4-dione |
| SMILES | C[C@@]1(O)CC[C@H]2[C@H](CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3[C@@H]3C[C@@H]3[C@@H]2C(=C=O)CN2C(=O)CSC2=O)C1 |
| InChI | InChI=1S/C26H35NO4S/c1-25(31)7-5-16-14(10-25)3-4-18-17(16)6-8-26(2)22(19-9-20(19)23(18)26)15(12-28)11-27-21(29)13-32-24(27)30/h14,16-20,22-23,31H,3-11,13H2,1-2H3/t14-,16+,17-,18-,19+,20-,22+,23-,25-,26-/m1/s1 |
| InChIKey | GQWFSNVSZBJEPY-GWDXBDGBSA-N |
| XLogP | 4.32 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|