C30H41N3O2 — CID 175722949
1-[2-[(3R,7S,8S,9S,12R,13S,16R)-16-hydroxy-9,16-dimethyl-8-pentacyclo[10.8.0.02,9.03,7.013,18]icosanyl]-3-oxoprop-2-enyl]-3-methylpyrazole-4-carbonitrile (PubChem CID 175722949) has the molecular formula C30H41N3O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is 1-[2-[(3R,7S,8S,9S,12R,13S,16R)-16-hydroxy-9,16-dimethyl-8-pentacyclo[10.8.0.02,9.03,7.013,18]icosanyl]-3-oxoprop-2-enyl]-3-methylpyrazole-4-carbonitrile.
| Compound Name | 1-[2-[(3R,7S,8S,9S,12R,13S,16R)-16-hydroxy-9,16-dimethyl-8-pentacyclo[10.8.0.02,9.03,7.013,18]icosanyl]-3-oxoprop-2-enyl]-3-methylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 175722949 |
| Molecular Formula | C30H41N3O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | 1-[2-[(3R,7S,8S,9S,12R,13S,16R)-16-hydroxy-9,16-dimethyl-8-pentacyclo[10.8.0.02,9.03,7.013,18]icosanyl]-3-oxoprop-2-enyl]-3-methylpyrazole-4-carbonitrile |
| SMILES | Cc1nn(CC(=C=O)[C@H]2[C@H]3CCCC3C3C4CCC5C[C@](C)(O)CC[C@@H]5[C@H]4CC[C@@]32C)cc1C#N |
| InChI | InChI=1S/C30H41N3O2/c1-18-20(14-31)15-33(32-18)16-21(17-34)27-24-5-4-6-25(24)28-26-8-7-19-13-29(2,35)11-9-22(19)23(26)10-12-30(27,28)3/h15,19,22-28,35H,4-13,16H2,1-3H3/t19?,22-,23+,24-,25?,26?,27-,28?,29+,30+/m0/s1 |
| InChIKey | KXBZDEPJRWLNHW-SPZYLPMOSA-N |
| XLogP | 5.48 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|