C30H41N3O2 — CID 139407735
5-cyclopropyl-1-[2-[(1R,2R,3R,4S,5S,6S,7S,10R,11S,14R,16R)-14-hydroxy-4,7,14-trimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-oxoethyl]pyrazole-4-carbonitrile (PubChem CID 139407735) has the molecular formula C30H41N3O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is 5-cyclopropyl-1-[2-[(1R,2R,3R,4S,5S,6S,7S,10R,11S,14R,16R)-14-hydroxy-4,7,14-trimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-oxoethyl]pyrazole-4-carbonitrile.
| Compound Name | 5-cyclopropyl-1-[2-[(1R,2R,3R,4S,5S,6S,7S,10R,11S,14R,16R)-14-hydroxy-4,7,14-trimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-oxoethyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 139407735 |
| Molecular Formula | C30H41N3O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | 5-cyclopropyl-1-[2-[(1R,2R,3R,4S,5S,6S,7S,10R,11S,14R,16R)-14-hydroxy-4,7,14-trimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-oxoethyl]pyrazole-4-carbonitrile |
| SMILES | C[C@H]1[C@@H]2[C@H]1[C@H](C(=O)Cn1ncc(C#N)c1C1CC1)[C@@]1(C)CC[C@H]3[C@@H](CC[C@@H]4C[C@](C)(O)CC[C@@H]43)[C@H]21 |
| InChI | InChI=1S/C30H41N3O2/c1-16-24-25(16)27(23(34)15-33-28(17-4-5-17)19(13-31)14-32-33)30(3)11-9-21-20-8-10-29(2,35)12-18(20)6-7-22(21)26(24)30/h14,16-18,20-22,24-27,35H,4-12,15H2,1-3H3/t16-,18+,20-,21+,22+,24+,25-,26+,27-,29+,30-/m0/s1 |
| InChIKey | JOJAMHRCXXAYIB-YYFKJRORSA-N |
| XLogP | 5.32 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |