C21H32N4O2 — CID 123750597
1-(3-hydroxy-3-methyl-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-(tetrazol-2-yl)ethanone (PubChem CID 123750597) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-(3-hydroxy-3-methyl-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-(tetrazol-2-yl)ethanone.
| Compound Name | 1-(3-hydroxy-3-methyl-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-(tetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 123750597 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 1-(3-hydroxy-3-methyl-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)-2-(tetrazol-2-yl)ethanone |
| SMILES | CC1(O)CCC2C(CCC3C2CCC2C(C(=O)Cn4ncnn4)CCC23)C1 |
| InChI | InChI=1S/C21H32N4O2/c1-21(27)9-8-14-13(10-21)2-3-16-15(14)4-5-18-17(16)6-7-19(18)20(26)11-25-23-12-22-24-25/h12-19,27H,2-11H2,1H3 |
| InChIKey | FLSUJRYJKBPPOP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |