C23H34N2O2 — CID 167407619
1-[(3R,5R,10S,13S,17S)-3-hydroxy-3-methyl-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]-2-pyrazol-1-ylethanone (PubChem CID 167407619) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 1-[(3R,5R,10S,13S,17S)-3-hydroxy-3-methyl-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]-2-pyrazol-1-ylethanone.
| Compound Name | 1-[(3R,5R,10S,13S,17S)-3-hydroxy-3-methyl-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]-2-pyrazol-1-ylethanone |
|---|---|
| PubChem CID | 167407619 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 1-[(3R,5R,10S,13S,17S)-3-hydroxy-3-methyl-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]-2-pyrazol-1-ylethanone |
| SMILES | C[C@@]1(O)CC[C@@H]2C3CC[C@H]4C(CC[C@@H]4C(=O)Cn4cccn4)C3CC[C@@H]2C1 |
| InChI | InChI=1S/C23H34N2O2/c1-23(27)10-9-16-15(13-23)3-4-18-17(16)5-6-20-19(18)7-8-21(20)22(26)14-25-12-2-11-24-25/h2,11-12,15-21,27H,3-10,13-14H2,1H3/t15-,16+,17?,18?,19?,20+,21+,23-/m1/s1 |
| InChIKey | NETHQLZOLVMDKE-SRYUVCNXSA-N |
| XLogP | 4.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |