C24H36N2O2 — CID 165371814
1-[(2S,5R,7R,14R)-5-hydroxy-5,14-dimethyl-13-tetracyclo[8.6.0.02,7.011,14]hexadecanyl]-3-pyrazol-1-ylpropan-2-one (PubChem CID 165371814) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 1-[(2S,5R,7R,14R)-5-hydroxy-5,14-dimethyl-13-tetracyclo[8.6.0.02,7.011,14]hexadecanyl]-3-pyrazol-1-ylpropan-2-one.
| Compound Name | 1-[(2S,5R,7R,14R)-5-hydroxy-5,14-dimethyl-13-tetracyclo[8.6.0.02,7.011,14]hexadecanyl]-3-pyrazol-1-ylpropan-2-one |
|---|---|
| PubChem CID | 165371814 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 1-[(2S,5R,7R,14R)-5-hydroxy-5,14-dimethyl-13-tetracyclo[8.6.0.02,7.011,14]hexadecanyl]-3-pyrazol-1-ylpropan-2-one |
| SMILES | C[C@@]1(O)CC[C@@H]2C3CC[C@]4(C)C(CC(=O)Cn5cccn5)CC4C3CC[C@@H]2C1 |
| InChI | InChI=1S/C24H36N2O2/c1-23(28)8-6-19-16(14-23)4-5-21-20(19)7-9-24(2)17(13-22(21)24)12-18(27)15-26-11-3-10-25-26/h3,10-11,16-17,19-22,28H,4-9,12-15H2,1-2H3/t16-,17?,19+,20?,21?,22?,23-,24-/m1/s1 |
| InChIKey | FWRVDEBAJAILCG-XRVHGCKCSA-N |
| XLogP | 4.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |