C20H34ClN5O4S — CID 139413748
N-[3-(diaminomethylideneamino)propyl]-2-[2-(octylsulfonylamino)phenyl]-2-oxoacetamide;hydrochloride (PubChem CID 139413748) has the molecular formula C20H34ClN5O4S and a molecular weight of 476.04 g/mol. Its IUPAC name is N-[3-(diaminomethylideneamino)propyl]-2-[2-(octylsulfonylamino)phenyl]-2-oxoacetamide;hydrochloride.
| Compound Name | N-[3-(diaminomethylideneamino)propyl]-2-[2-(octylsulfonylamino)phenyl]-2-oxoacetamide;hydrochloride |
|---|---|
| PubChem CID | 139413748 |
| Molecular Formula | C20H34ClN5O4S |
| Molecular Weight | 476.04 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | N-[3-(diaminomethylideneamino)propyl]-2-[2-(octylsulfonylamino)phenyl]-2-oxoacetamide;hydrochloride |
| SMILES | CCCCCCCCS(=O)(=O)Nc1ccccc1C(=O)C(=O)NCCCN=C(N)N.Cl |
| InChI | InChI=1S/C20H33N5O4S.ClH/c1-2-3-4-5-6-9-15-30(28,29)25-17-12-8-7-11-16(17)18(26)19(27)23-13-10-14-24-20(21)22;/h7-8,11-12,25H,2-6,9-10,13-15H2,1H3,(H,23,27)(H4,21,22,24);1H |
| InChIKey | LPEGQFRLTMSVHH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.04 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|