C15H16F7NO3 — CID 139414552
4,4,5,5-tetrafluoro-3-hydroxy-3-methyl-N-[1-[3-(trifluoromethoxy)phenyl]ethyl]pentanamide (PubChem CID 139414552) has the molecular formula C15H16F7NO3 and a molecular weight of 391.28 g/mol. Its IUPAC name is 4,4,5,5-tetrafluoro-3-hydroxy-3-methyl-N-[1-[3-(trifluoromethoxy)phenyl]ethyl]pentanamide.
| Compound Name | 4,4,5,5-tetrafluoro-3-hydroxy-3-methyl-N-[1-[3-(trifluoromethoxy)phenyl]ethyl]pentanamide |
|---|---|
| PubChem CID | 139414552 |
| Molecular Formula | C15H16F7NO3 |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 4,4,5,5-tetrafluoro-3-hydroxy-3-methyl-N-[1-[3-(trifluoromethoxy)phenyl]ethyl]pentanamide |
| SMILES | CC(NC(=O)CC(C)(O)C(F)(F)C(F)F)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F7NO3/c1-8(9-4-3-5-10(6-9)26-15(20,21)22)23-11(24)7-13(2,25)14(18,19)12(16)17/h3-6,8,12,25H,7H2,1-2H3,(H,23,24) |
| InChIKey | UCQCOAQSODWNFL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|