C19H24F3N3O2 — CID 171931063
butan-2-amine;N-[1-[3-(trifluoromethoxy)phenyl]ethyl]pyridine-4-carboxamide (PubChem CID 171931063) has the molecular formula C19H24F3N3O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is butan-2-amine;N-[1-[3-(trifluoromethoxy)phenyl]ethyl]pyridine-4-carboxamide.
| Compound Name | butan-2-amine;N-[1-[3-(trifluoromethoxy)phenyl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 171931063 |
| Molecular Formula | C19H24F3N3O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | butan-2-amine;N-[1-[3-(trifluoromethoxy)phenyl]ethyl]pyridine-4-carboxamide |
| SMILES | CC(NC(=O)c1ccncc1)c1cccc(OC(F)(F)F)c1.CCC(C)N |
| InChI | InChI=1S/C15H13F3N2O2.C4H11N/c1-10(20-14(21)11-5-7-19-8-6-11)12-3-2-4-13(9-12)22-15(16,17)18;1-3-4(2)5/h2-10H,1H3,(H,20,21);4H,3,5H2,1-2H3 |
| InChIKey | BWXRRUYKLDNKFA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |