C17H16F4N2O2 — CID 160840469
2-methyl-N-[1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]pyridine-4-carboxamide (PubChem CID 160840469) has the molecular formula C17H16F4N2O2 and a molecular weight of 356.32 g/mol. Its IUPAC name is 2-methyl-N-[1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-methyl-N-[1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 160840469 |
| Molecular Formula | C17H16F4N2O2 |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-methyl-N-[1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)c2cccc(OC(F)(F)C(F)F)c2)ccn1 |
| InChI | InChI=1S/C17H16F4N2O2/c1-10-8-13(6-7-22-10)15(24)23-11(2)12-4-3-5-14(9-12)25-17(20,21)16(18)19/h3-9,11,16H,1-2H3,(H,23,24) |
| InChIKey | BYNPNHWSTKPVFX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|