C19H16F2N2O2 — CID 154858888
N-[1-[3-(difluoromethoxy)phenyl]ethyl]quinoline-6-carboxamide (PubChem CID 154858888) has the molecular formula C19H16F2N2O2 and a molecular weight of 342.35 g/mol. Its IUPAC name is N-[1-[3-(difluoromethoxy)phenyl]ethyl]quinoline-6-carboxamide.
| Compound Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 154858888 |
| Molecular Formula | C19H16F2N2O2 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]quinoline-6-carboxamide |
| SMILES | CC(NC(=O)c1ccc2ncccc2c1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C19H16F2N2O2/c1-12(13-4-2-6-16(11-13)25-19(20)21)23-18(24)15-7-8-17-14(10-15)5-3-9-22-17/h2-12,19H,1H3,(H,23,24) |
| InChIKey | YMERFRGDNNKHIY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |