C16H17F2N3O2 — CID 133316843
2-[1-[3-(difluoromethoxy)phenyl]ethylamino]-N-methylpyridine-3-carboxamide (PubChem CID 133316843) has the molecular formula C16H17F2N3O2 and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-[1-[3-(difluoromethoxy)phenyl]ethylamino]-N-methylpyridine-3-carboxamide.
| Compound Name | 2-[1-[3-(difluoromethoxy)phenyl]ethylamino]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133316843 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-[1-[3-(difluoromethoxy)phenyl]ethylamino]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cccnc1NC(C)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C16H17F2N3O2/c1-10(11-5-3-6-12(9-11)23-16(17)18)21-14-13(15(22)19-2)7-4-8-20-14/h3-10,16H,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | OHQDSUAKHNNYOK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |