C23H30ClN5O2 — CID 139417575
(4-chloropyrazol-1-yl)-[7-[(2-methyl-4-morpholin-4-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonan-2-yl]methanone (PubChem CID 139417575) has the molecular formula C23H30ClN5O2 and a molecular weight of 443.98 g/mol. Its IUPAC name is (4-chloropyrazol-1-yl)-[7-[(2-methyl-4-morpholin-4-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonan-2-yl]methanone.
| Compound Name | (4-chloropyrazol-1-yl)-[7-[(2-methyl-4-morpholin-4-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonan-2-yl]methanone |
|---|---|
| PubChem CID | 139417575 |
| Molecular Formula | C23H30ClN5O2 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (4-chloropyrazol-1-yl)-[7-[(2-methyl-4-morpholin-4-ylphenyl)methyl]-2,7-diazaspiro[4.4]nonan-2-yl]methanone |
| SMILES | Cc1cc(N2CCOCC2)ccc1CN1CCC2(CCN(C(=O)n3cc(Cl)cn3)C2)C1 |
| InChI | InChI=1S/C23H30ClN5O2/c1-18-12-21(27-8-10-31-11-9-27)3-2-19(18)14-26-6-4-23(16-26)5-7-28(17-23)22(30)29-15-20(24)13-25-29/h2-3,12-13,15H,4-11,14,16-17H2,1H3 |
| InChIKey | MKAYATHPHKVMFZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|