C12H17N3O4 — CID 139418553
N-[1-[5-(2-hydroxyethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide (PubChem CID 139418553) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is N-[1-[5-(2-hydroxyethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide.
| Compound Name | N-[1-[5-(2-hydroxyethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 139418553 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-[1-[5-(2-hydroxyethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| SMILES | CC(=O)Nc1ccn(C2CCC(CCO)O2)c(=O)n1 |
| InChI | InChI=1S/C12H17N3O4/c1-8(17)13-10-4-6-15(12(18)14-10)11-3-2-9(19-11)5-7-16/h4,6,9,11,16H,2-3,5,7H2,1H3,(H,13,14,17,18) |
| InChIKey | FIEGAIUQKREJLR-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |