C23H29NO5 — CID 139419247
4-[[(2S,5R)-1-tert-butylperoxy-5-[(R)-hydroxy(phenyl)methyl]pyrrolidin-2-yl]methyl]benzoic acid (PubChem CID 139419247) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-[[(2S,5R)-1-tert-butylperoxy-5-[(R)-hydroxy(phenyl)methyl]pyrrolidin-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[(2S,5R)-1-tert-butylperoxy-5-[(R)-hydroxy(phenyl)methyl]pyrrolidin-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 139419247 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 4-[[(2S,5R)-1-tert-butylperoxy-5-[(R)-hydroxy(phenyl)methyl]pyrrolidin-2-yl]methyl]benzoic acid |
| SMILES | CC(C)(C)OON1[C@H](Cc2ccc(C(=O)O)cc2)CC[C@@H]1[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H29NO5/c1-23(2,3)28-29-24-19(15-16-9-11-18(12-10-16)22(26)27)13-14-20(24)21(25)17-7-5-4-6-8-17/h4-12,19-21,25H,13-15H2,1-3H3,(H,26,27)/t19-,20+,21+/m0/s1 |
| InChIKey | IWOIXHQXGXJEFH-PWRODBHTSA-N |
| XLogP | 4.16 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|