C31H47N5 — CID 139420164
2-methyl-N'-[4-[[7-[methyl(pentyl)amino]-2,3-dihydroquinoxalin-5-yl]methyl]cyclohexyl]-N-prop-1-en-2-ylcyclopentene-1-carboximidamide (PubChem CID 139420164) has the molecular formula C31H47N5 and a molecular weight of 489.75 g/mol. Its IUPAC name is 2-methyl-N'-[4-[[7-[methyl(pentyl)amino]-2,3-dihydroquinoxalin-5-yl]methyl]cyclohexyl]-N-prop-1-en-2-ylcyclopentene-1-carboximidamide.
| Compound Name | 2-methyl-N'-[4-[[7-[methyl(pentyl)amino]-2,3-dihydroquinoxalin-5-yl]methyl]cyclohexyl]-N-prop-1-en-2-ylcyclopentene-1-carboximidamide |
|---|---|
| PubChem CID | 139420164 |
| Molecular Formula | C31H47N5 |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 489.38 |
| IUPAC Name | 2-methyl-N'-[4-[[7-[methyl(pentyl)amino]-2,3-dihydroquinoxalin-5-yl]methyl]cyclohexyl]-N-prop-1-en-2-ylcyclopentene-1-carboximidamide |
| SMILES | C=C(C)N/C(=N\C1CCC(Cc2cc(N(C)CCCCC)cc3c2=NCCN=3)CC1)C1=C(C)CCC1 |
| InChI | InChI=1S/C31H47N5/c1-6-7-8-18-36(5)27-20-25(30-29(21-27)32-16-17-33-30)19-24-12-14-26(15-13-24)35-31(34-22(2)3)28-11-9-10-23(28)4/h20-21,24,26H,2,6-19H2,1,3-5H3,(H,34,35) |
| InChIKey | UJVZSQOYRBVLLJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|