C27H28N6OS — CID 139422109
6-(4-imidazo[1,2-a]pyridin-5-ylpiperazin-1-yl)-1-[2-(4-methylphenyl)sulfanyloxyethyl]pyrrolo[2,3-b]pyridine (PubChem CID 139422109) has the molecular formula C27H28N6OS and a molecular weight of 484.63 g/mol. Its IUPAC name is 6-(4-imidazo[1,2-a]pyridin-5-ylpiperazin-1-yl)-1-[2-(4-methylphenyl)sulfanyloxyethyl]pyrrolo[2,3-b]pyridine.
| Compound Name | 6-(4-imidazo[1,2-a]pyridin-5-ylpiperazin-1-yl)-1-[2-(4-methylphenyl)sulfanyloxyethyl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 139422109 |
| Molecular Formula | C27H28N6OS |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 6-(4-imidazo[1,2-a]pyridin-5-ylpiperazin-1-yl)-1-[2-(4-methylphenyl)sulfanyloxyethyl]pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(SOCCn2ccc3ccc(N4CCN(c5cccc6nccn56)CC4)nc32)cc1 |
| InChI | InChI=1S/C27H28N6OS/c1-21-5-8-23(9-6-21)35-34-20-19-32-13-11-22-7-10-25(29-27(22)32)30-15-17-31(18-16-30)26-4-2-3-24-28-12-14-33(24)26/h2-14H,15-20H2,1H3 |
| InChIKey | MFUVZXJZJBLQBD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 50.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|