C26H32N6 — CID 139425813
6-[4-(4-ethylphenyl)piperazin-1-yl]-1-(2-pyrrolidin-1-ylethyl)pyrrolo[2,3-b]pyridine-4-carbonitrile (PubChem CID 139425813) has the molecular formula C26H32N6 and a molecular weight of 428.58 g/mol. Its IUPAC name is 6-[4-(4-ethylphenyl)piperazin-1-yl]-1-(2-pyrrolidin-1-ylethyl)pyrrolo[2,3-b]pyridine-4-carbonitrile.
| Compound Name | 6-[4-(4-ethylphenyl)piperazin-1-yl]-1-(2-pyrrolidin-1-ylethyl)pyrrolo[2,3-b]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 139425813 |
| Molecular Formula | C26H32N6 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 6-[4-(4-ethylphenyl)piperazin-1-yl]-1-(2-pyrrolidin-1-ylethyl)pyrrolo[2,3-b]pyridine-4-carbonitrile |
| SMILES | CCc1ccc(N2CCN(c3cc(C#N)c4ccn(CCN5CCCC5)c4n3)CC2)cc1 |
| InChI | InChI=1S/C26H32N6/c1-2-21-5-7-23(8-6-21)30-15-17-31(18-16-30)25-19-22(20-27)24-9-12-32(26(24)28-25)14-13-29-10-3-4-11-29/h5-9,12,19H,2-4,10-11,13-18H2,1H3 |
| InChIKey | OMBDWMGMSHKYMA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|