C24H32N6 — CID 139425819
6-[4-(4-ethylphenyl)piperazin-1-yl]-1-(2-pyrrolidin-1-ylethyl)pyrazolo[5,4-b]pyridine (PubChem CID 139425819) has the molecular formula C24H32N6 and a molecular weight of 404.56 g/mol. Its IUPAC name is 6-[4-(4-ethylphenyl)piperazin-1-yl]-1-(2-pyrrolidin-1-ylethyl)pyrazolo[5,4-b]pyridine.
| Compound Name | 6-[4-(4-ethylphenyl)piperazin-1-yl]-1-(2-pyrrolidin-1-ylethyl)pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 139425819 |
| Molecular Formula | C24H32N6 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 6-[4-(4-ethylphenyl)piperazin-1-yl]-1-(2-pyrrolidin-1-ylethyl)pyrazolo[5,4-b]pyridine |
| SMILES | CCc1ccc(N2CCN(c3ccc4cnn(CCN5CCCC5)c4n3)CC2)cc1 |
| InChI | InChI=1S/C24H32N6/c1-2-20-5-8-22(9-6-20)28-14-16-29(17-15-28)23-10-7-21-19-25-30(24(21)26-23)18-13-27-11-3-4-12-27/h5-10,19H,2-4,11-18H2,1H3 |
| InChIKey | IGKQNXCTPQHWOB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|