C22H24N6O — CID 70276501
2-(4-ethylphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one (PubChem CID 70276501) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one.
| Compound Name | 2-(4-ethylphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one |
|---|---|
| PubChem CID | 70276501 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-(4-ethylphenyl)-8-(4-methylpiperazin-1-yl)-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one |
| SMILES | CCc1ccc(-n2[nH]c3c(cnc4ccc(N5CCN(C)CC5)nc43)c2=O)cc1 |
| InChI | InChI=1S/C22H24N6O/c1-3-15-4-6-16(7-5-15)28-22(29)17-14-23-18-8-9-19(24-21(18)20(17)25-28)27-12-10-26(2)11-13-27/h4-9,14,25H,3,10-13H2,1-2H3 |
| InChIKey | ZSUAGOYOPSNRLU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|