C16H15N5O2 — CID 10040978
10-(2-hydroxyethyl)-11-methyl-4-phenyl-3,4,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one (PubChem CID 10040978) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 10-(2-hydroxyethyl)-11-methyl-4-phenyl-3,4,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one.
| Compound Name | 10-(2-hydroxyethyl)-11-methyl-4-phenyl-3,4,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one |
|---|---|
| PubChem CID | 10040978 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 10-(2-hydroxyethyl)-11-methyl-4-phenyl-3,4,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one |
| SMILES | Cc1nc2c3[nH]n(-c4ccccc4)c(=O)c3cnc2n1CCO |
| InChI | InChI=1S/C16H15N5O2/c1-10-18-14-13-12(9-17-15(14)20(10)7-8-22)16(23)21(19-13)11-5-3-2-4-6-11/h2-6,9,19,22H,7-8H2,1H3 |
| InChIKey | VJMAZXYBPBEDEC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|