C20H21N7O — CID 25124790
8-(4-methyl-1,4-diazepan-1-yl)-2-pyridin-2-yl-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one (PubChem CID 25124790) has the molecular formula C20H21N7O and a molecular weight of 375.44 g/mol. Its IUPAC name is 8-(4-methyl-1,4-diazepan-1-yl)-2-pyridin-2-yl-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one.
| Compound Name | 8-(4-methyl-1,4-diazepan-1-yl)-2-pyridin-2-yl-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one |
|---|---|
| PubChem CID | 25124790 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 8-(4-methyl-1,4-diazepan-1-yl)-2-pyridin-2-yl-1H-pyrazolo[4,3-c][1,5]naphthyridin-3-one |
| SMILES | CN1CCCN(c2ccc3ncc4c(=O)n(-c5ccccn5)[nH]c4c3n2)CC1 |
| InChI | InChI=1S/C20H21N7O/c1-25-9-4-10-26(12-11-25)17-7-6-15-19(23-17)18-14(13-22-15)20(28)27(24-18)16-5-2-3-8-21-16/h2-3,5-8,13,24H,4,9-12H2,1H3 |
| InChIKey | HPGOBLDBPFTJFN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|