C20H22Cl2N6OS — CID 139427395
(3R,4S)-8-[8-(2,3-dichlorophenyl)sulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine (PubChem CID 139427395) has the molecular formula C20H22Cl2N6OS and a molecular weight of 465.41 g/mol. Its IUPAC name is (3R,4S)-8-[8-(2,3-dichlorophenyl)sulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (3R,4S)-8-[8-(2,3-dichlorophenyl)sulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 139427395 |
| Molecular Formula | C20H22Cl2N6OS |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (3R,4S)-8-[8-(2,3-dichlorophenyl)sulfanyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine |
| SMILES | C[C@H]1OCC2(CCN(c3ncc(Sc4cccc(Cl)c4Cl)c4ncnn34)CC2)[C@@H]1N |
| InChI | InChI=1S/C20H22Cl2N6OS/c1-12-17(23)20(10-29-12)5-7-27(8-6-20)19-24-9-15(18-25-11-26-28(18)19)30-14-4-2-3-13(21)16(14)22/h2-4,9,11-12,17H,5-8,10,23H2,1H3/t12-,17-/m1/s1 |
| InChIKey | IVPUUMZUBCQIBM-SJKOYZFVSA-N |
| XLogP | 3.91 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |