C19H21Cl2N7OS — CID 139427454
(3S,4S)-8-[8-[(2,3-dichloro-4-pyridinyl)sulfanyl]-[1,2,4]triazolo[4,3-c]pyrimidin-5-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine (PubChem CID 139427454) has the molecular formula C19H21Cl2N7OS and a molecular weight of 466.40 g/mol. Its IUPAC name is (3S,4S)-8-[8-[(2,3-dichloro-4-pyridinyl)sulfanyl]-[1,2,4]triazolo[4,3-c]pyrimidin-5-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (3S,4S)-8-[8-[(2,3-dichloro-4-pyridinyl)sulfanyl]-[1,2,4]triazolo[4,3-c]pyrimidin-5-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 139427454 |
| Molecular Formula | C19H21Cl2N7OS |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | (3S,4S)-8-[8-[(2,3-dichloro-4-pyridinyl)sulfanyl]-[1,2,4]triazolo[4,3-c]pyrimidin-5-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine |
| SMILES | C[C@@H]1OCC2(CCN(c3ncc(Sc4ccnc(Cl)c4Cl)c4nncn34)CC2)[C@@H]1N |
| InChI | InChI=1S/C19H21Cl2N7OS/c1-11-15(22)19(9-29-11)3-6-27(7-4-19)18-24-8-13(17-26-25-10-28(17)18)30-12-2-5-23-16(21)14(12)20/h2,5,8,10-11,15H,3-4,6-7,9,22H2,1H3/t11-,15+/m0/s1 |
| InChIKey | MGOAOPJTXYGPMG-XHDPSFHLSA-N |
| XLogP | 3.31 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|