C19H20Cl2N6OS — CID 139427310
(4S)-8-[8-[(2,3-dichloro-4-pyridinyl)sulfanyl]imidazo[1,2-c]pyrimidin-5-yl]-2-oxa-8-azaspiro[4.5]decan-4-amine (PubChem CID 139427310) has the molecular formula C19H20Cl2N6OS and a molecular weight of 451.38 g/mol. Its IUPAC name is (4S)-8-[8-[(2,3-dichloro-4-pyridinyl)sulfanyl]imidazo[1,2-c]pyrimidin-5-yl]-2-oxa-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (4S)-8-[8-[(2,3-dichloro-4-pyridinyl)sulfanyl]imidazo[1,2-c]pyrimidin-5-yl]-2-oxa-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 139427310 |
| Molecular Formula | C19H20Cl2N6OS |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | (4S)-8-[8-[(2,3-dichloro-4-pyridinyl)sulfanyl]imidazo[1,2-c]pyrimidin-5-yl]-2-oxa-8-azaspiro[4.5]decan-4-amine |
| SMILES | N[C@@H]1COCC12CCN(c1ncc(Sc3ccnc(Cl)c3Cl)c3nccn13)CC2 |
| InChI | InChI=1S/C19H20Cl2N6OS/c20-15-12(1-4-23-16(15)21)29-13-9-25-18(27-8-5-24-17(13)27)26-6-2-19(3-7-26)11-28-10-14(19)22/h1,4-5,8-9,14H,2-3,6-7,10-11,22H2/t14-/m1/s1 |
| InChIKey | JVQXXFVNXXOYFA-CQSZACIVSA-N |
| XLogP | 3.53 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|