C14H17F3N2O3 — CID 139431923
1-(1H-indol-3-yl)-3-methoxypropan-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 139431923) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-3-methoxypropan-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(1H-indol-3-yl)-3-methoxypropan-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 139431923 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-(1H-indol-3-yl)-3-methoxypropan-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | COCC(N)Cc1c[nH]c2ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H16N2O.C2HF3O2/c1-15-8-10(13)6-9-7-14-12-5-3-2-4-11(9)12;3-2(4,5)1(6)7/h2-5,7,10,14H,6,8,13H2,1H3;(H,6,7) |
| InChIKey | HTBWDBASRLXTBB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |