C24H28FN3O2S — CID 139431960
4-[(1S,3S)-3-butyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-N-cyclopropyl-3-fluorobenzenesulfonamide (PubChem CID 139431960) has the molecular formula C24H28FN3O2S and a molecular weight of 441.57 g/mol. Its IUPAC name is 4-[(1S,3S)-3-butyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-N-cyclopropyl-3-fluorobenzenesulfonamide.
| Compound Name | 4-[(1S,3S)-3-butyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-N-cyclopropyl-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 139431960 |
| Molecular Formula | C24H28FN3O2S |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-[(1S,3S)-3-butyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-N-cyclopropyl-3-fluorobenzenesulfonamide |
| SMILES | CCCC[C@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccc(S(=O)(=O)NC3CC3)cc2F)N1 |
| InChI | InChI=1S/C24H28FN3O2S/c1-2-3-6-16-13-20-18-7-4-5-8-22(18)27-24(20)23(26-16)19-12-11-17(14-21(19)25)31(29,30)28-15-9-10-15/h4-5,7-8,11-12,14-16,23,26-28H,2-3,6,9-10,13H2,1H3/t16-,23-/m0/s1 |
| InChIKey | YXRLHOZEIKCVHZ-HJPURHCSSA-N |
| XLogP | 4.54 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|