C19H14O3 — CID 139434157
4-(9H-fluoren-1-yl)benzene-1,2,3-triol (PubChem CID 139434157) has the molecular formula C19H14O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-(9H-fluoren-1-yl)benzene-1,2,3-triol.
| Compound Name | 4-(9H-fluoren-1-yl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 139434157 |
| Molecular Formula | C19H14O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-(9H-fluoren-1-yl)benzene-1,2,3-triol |
| SMILES | Oc1ccc(-c2cccc3c2Cc2ccccc2-3)c(O)c1O |
| InChI | InChI=1S/C19H14O3/c20-17-9-8-15(18(21)19(17)22)14-7-3-6-13-12-5-2-1-4-11(12)10-16(13)14/h1-9,20-22H,10H2 |
| InChIKey | KZQIIFWNIUXCCN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|