C25H18O4 — CID 141152647
3-[1-(2,3-dihydroxyphenyl)-9H-fluoren-2-yl]benzene-1,2-diol (PubChem CID 141152647) has the molecular formula C25H18O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-[1-(2,3-dihydroxyphenyl)-9H-fluoren-2-yl]benzene-1,2-diol.
| Compound Name | 3-[1-(2,3-dihydroxyphenyl)-9H-fluoren-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 141152647 |
| Molecular Formula | C25H18O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-[1-(2,3-dihydroxyphenyl)-9H-fluoren-2-yl]benzene-1,2-diol |
| SMILES | Oc1cccc(-c2ccc3c(c2-c2cccc(O)c2O)Cc2ccccc2-3)c1O |
| InChI | InChI=1S/C25H18O4/c26-21-9-3-7-18(24(21)28)17-12-11-16-15-6-2-1-5-14(15)13-20(16)23(17)19-8-4-10-22(27)25(19)29/h1-12,26-29H,13H2 |
| InChIKey | WXVOCXRYTMJKOQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|