C9H16F2 — CID 139440730
(E)-7,7-difluoro-2,6-dimethylhept-3-ene (PubChem CID 139440730) has the molecular formula C9H16F2 and a molecular weight of 162.22 g/mol. Its IUPAC name is (E)-7,7-difluoro-2,6-dimethylhept-3-ene.
| Compound Name | (E)-7,7-difluoro-2,6-dimethylhept-3-ene |
|---|---|
| PubChem CID | 139440730 |
| Molecular Formula | C9H16F2 |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (E)-7,7-difluoro-2,6-dimethylhept-3-ene |
| SMILES | CC(C)/C=C/CC(C)C(F)F |
| InChI | InChI=1S/C9H16F2/c1-7(2)5-4-6-8(3)9(10)11/h4-5,7-9H,6H2,1-3H3/b5-4+ |
| InChIKey | CUZHAIZKBZUSCJ-SNAWJCMRSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|