C17H33N — CID 155264326
(7E,10E)-2,4,5,12-tetramethyltrideca-7,10-dien-3-amine (PubChem CID 155264326) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is (7E,10E)-2,4,5,12-tetramethyltrideca-7,10-dien-3-amine.
| Compound Name | (7E,10E)-2,4,5,12-tetramethyltrideca-7,10-dien-3-amine |
|---|---|
| PubChem CID | 155264326 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | (7E,10E)-2,4,5,12-tetramethyltrideca-7,10-dien-3-amine |
| SMILES | CC(C)/C=C/C/C=C/CC(C)C(C)C(N)C(C)C |
| InChI | InChI=1S/C17H33N/c1-13(2)11-9-7-8-10-12-15(5)16(6)17(18)14(3)4/h8-11,13-17H,7,12,18H2,1-6H3/b10-8+,11-9+ |
| InChIKey | RZYVUKYANFRIKM-GFULKKFKSA-N |
| XLogP | 4.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|