C27H27N5O3S — CID 139440993
5-(1-methyl-2-oxo-4-pyridinyl)-N-[1-[(4R)-1-prop-2-enoylazepan-4-yl]benzimidazol-2-yl]thiophene-2-carboxamide (PubChem CID 139440993) has the molecular formula C27H27N5O3S and a molecular weight of 501.61 g/mol. Its IUPAC name is 5-(1-methyl-2-oxo-4-pyridinyl)-N-[1-[(4R)-1-prop-2-enoylazepan-4-yl]benzimidazol-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-(1-methyl-2-oxo-4-pyridinyl)-N-[1-[(4R)-1-prop-2-enoylazepan-4-yl]benzimidazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 139440993 |
| Molecular Formula | C27H27N5O3S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 5-(1-methyl-2-oxo-4-pyridinyl)-N-[1-[(4R)-1-prop-2-enoylazepan-4-yl]benzimidazol-2-yl]thiophene-2-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H](n2c(NC(=O)c3ccc(-c4ccn(C)c(=O)c4)s3)nc3ccccc32)CC1 |
| InChI | InChI=1S/C27H27N5O3S/c1-3-24(33)31-14-6-7-19(13-16-31)32-21-9-5-4-8-20(21)28-27(32)29-26(35)23-11-10-22(36-23)18-12-15-30(2)25(34)17-18/h3-5,8-12,15,17,19H,1,6-7,13-14,16H2,2H3,(H,28,29,35)/t19-/m1/s1 |
| InChIKey | RPBXXJQNXUJEKK-LJQANCHMSA-N |
| XLogP | 4.46 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|