C26H24FN5O2S — CID 139441030
5-(2-fluoro-4-pyridinyl)-N-[1-[(4R)-1-prop-2-enoylazepan-4-yl]benzimidazol-2-yl]thiophene-2-carboxamide (PubChem CID 139441030) has the molecular formula C26H24FN5O2S and a molecular weight of 489.58 g/mol. Its IUPAC name is 5-(2-fluoro-4-pyridinyl)-N-[1-[(4R)-1-prop-2-enoylazepan-4-yl]benzimidazol-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-(2-fluoro-4-pyridinyl)-N-[1-[(4R)-1-prop-2-enoylazepan-4-yl]benzimidazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 139441030 |
| Molecular Formula | C26H24FN5O2S |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 5-(2-fluoro-4-pyridinyl)-N-[1-[(4R)-1-prop-2-enoylazepan-4-yl]benzimidazol-2-yl]thiophene-2-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H](n2c(NC(=O)c3ccc(-c4ccnc(F)c4)s3)nc3ccccc32)CC1 |
| InChI | InChI=1S/C26H24FN5O2S/c1-2-24(33)31-14-5-6-18(12-15-31)32-20-8-4-3-7-19(20)29-26(32)30-25(34)22-10-9-21(35-22)17-11-13-28-23(27)16-17/h2-4,7-11,13,16,18H,1,5-6,12,14-15H2,(H,29,30,34)/t18-/m1/s1 |
| InChIKey | KVSZHMCMBSEHEK-GOSISDBHSA-N |
| XLogP | 5.29 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|