C17H32O7S — CID 139441892
(2S,3S,4R,5S,6R)-3-(2,3-dimethylbutan-2-yloxy)-4,5-dihydroxy-6-[2-(methylsulfanylmethoxy)propan-2-yl]oxane-2-carboxylic acid (PubChem CID 139441892) has the molecular formula C17H32O7S and a molecular weight of 380.50 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-3-(2,3-dimethylbutan-2-yloxy)-4,5-dihydroxy-6-[2-(methylsulfanylmethoxy)propan-2-yl]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5S,6R)-3-(2,3-dimethylbutan-2-yloxy)-4,5-dihydroxy-6-[2-(methylsulfanylmethoxy)propan-2-yl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 139441892 |
| Molecular Formula | C17H32O7S |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (2S,3S,4R,5S,6R)-3-(2,3-dimethylbutan-2-yloxy)-4,5-dihydroxy-6-[2-(methylsulfanylmethoxy)propan-2-yl]oxane-2-carboxylic acid |
| SMILES | CSCOC(C)(C)[C@@H]1O[C@H](C(=O)O)[C@@H](OC(C)(C)C(C)C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H32O7S/c1-9(2)16(3,4)24-12-10(18)11(19)14(23-13(12)15(20)21)17(5,6)22-8-25-7/h9-14,18-19H,8H2,1-7H3,(H,20,21)/t10-,11+,12+,13+,14-/m1/s1 |
| InChIKey | STRCXNKGYDJDDP-IKOXMDCHSA-N |
| XLogP | 1.50 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|