C15H16N4O — CID 139442921
1-(4-anilino-3-methanimidoylphenyl)-3-methylurea (PubChem CID 139442921) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-(4-anilino-3-methanimidoylphenyl)-3-methylurea.
| Compound Name | 1-(4-anilino-3-methanimidoylphenyl)-3-methylurea |
|---|---|
| PubChem CID | 139442921 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-(4-anilino-3-methanimidoylphenyl)-3-methylurea |
| SMILES | [H]/N=C/c1cc(NC(=O)NC)ccc1Nc1ccccc1 |
| InChI | InChI=1S/C15H16N4O/c1-17-15(20)19-13-7-8-14(11(9-13)10-16)18-12-5-3-2-4-6-12/h2-10,16,18H,1H3,(H2,17,19,20)/b16-10+ |
| InChIKey | QLZSDKSAYHUWBQ-MHWRWJLKSA-N |
| XLogP | 3.18 |
| TPSA | 77.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|